Products 852946-98-6
CAS 852946-98-6 appears in our catalog under these names: 2-Ethyl-5-methoxyphenylboronic acid, 98%, (2-Ethyl-5-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2-ethyl-5-methoxyphenyl)boronic acid (CAS 852946-98-6) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-ethyl-5-methoxyphenyl)boronic acid. InChIKey: RPWSVXFPDYETAQ-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-ethyl-5-methoxyphenyl)boronic acid |
| InChIKey | RPWSVXFPDYETAQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)CC)(O)O |
Computed by PubChem (NCBI)