CAS 2121513-77-5 appears in our catalog under these names: 4-(Hydroxymethyl)-2,6-dimethylphenylboronic acid, 95%, (4-(Hydroxymethyl)-2,6-dimethylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[4-(hydroxymethyl)-2,6-dimethylphenyl]boronic acid (CAS 2121513-77-5) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: [4-(hydroxymethyl)-2,6-dimethylphenyl]boronic acid. InChIKey: BGGDJNYSKZIBRN-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | [4-(hydroxymethyl)-2,6-dimethylphenyl]boronic acid |
| InChIKey | BGGDJNYSKZIBRN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)CO)C)(O)O |
Computed by PubChem (NCBI)