Products 2121514-80-3
CAS 2121514-80-3 appears in our catalog under these names: 3-Ethyl-4-(hydroxymethyl)phenylboronic acid, 95%, (3-Ethyl-4-(hydroxymethyl)phenyl)boronic acid, 98%, Boronic acid, B-[3-ethyl-4-(hydroxymethyl)phenyl]-, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[3-ethyl-4-(hydroxymethyl)phenyl]boronic acid (CAS 2121514-80-3) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: [3-ethyl-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: NGKOEEYGZSEUFF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | [3-ethyl-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | NGKOEEYGZSEUFF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)CC)(O)O |
Computed by PubChem (NCBI)