4-Fluoroindoline-2,3-dione, 95%
cas: 346-34-9 — see every product listed under this CAS number, including other names
4-Fluoroindoline-2,3-dione, 95% (CAS 346-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077886-100MG |
| cas | 346-34-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2424.16 Pln | |
| Fluorochem | 10g | 4376.60 Pln | |
| Fluorochem | 25g | 10228.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-1H-indole-2,3-dione (CAS 346-34-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 4-fluoro-1H-indole-2,3-dione. InChIKey: VUPIFURSDLGPMH-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 4-fluoro-1H-indole-2,3-dione |
| InChIKey | VUPIFURSDLGPMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)