4-Fluoroindoline-2,3-dione, 95%
cas: 346-34-9 — see every product listed under this CAS number, including other names
4-Fluoroindoline-2,3-dione, 95% (CAS 346-34-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A215922-250mg |
| cas | 346-34-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2283.88 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 664.24 Pln | |
| BLDpharm | 5g | 2452.49 Pln | |
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 2340.86 Pln | |
| Fluorochem | 10g | 4511.97 Pln | |
| Fluorochem | 25g | 10338.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-fluoro-1H-indole-2,3-dione (CAS 346-34-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 4-fluoro-1H-indole-2,3-dione. InChIKey: VUPIFURSDLGPMH-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 4-fluoro-1H-indole-2,3-dione |
| InChIKey | VUPIFURSDLGPMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)