cas: 203937-50-2 — see every product listed under this CAS number, including other names
4-Methoxy-1H-indole-3-carboxylic acid 96% (CAS 203937-50-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A574043-250mg |
| cas | 203937-50-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A574043 |
4-methoxy-1H-indole-3-carboxylic acid (CAS 203937-50-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-methoxy-1H-indole-3-carboxylic acid. InChIKey: CWWWWJZMLMUDIM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-methoxy-1H-indole-3-carboxylic acid |
| InChIKey | CWWWWJZMLMUDIM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)C(=O)O |
Computed by PubChem (NCBI)