CAS 203937-50-2 appears in our catalog under these names: 4-Methoxyindole-3-carboxylic acid, 96%, 4-Methoxy-1H-indole-3-carboxylic acid, 98%, 4–Methoxy–1H–indole–3–carboxylic acid, 4-Methoxy-1H-indole-3-carboxylic acid 96%, 4-Methoxy-1H-indole-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
4-methoxy-1H-indole-3-carboxylic acid (CAS 203937-50-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-methoxy-1H-indole-3-carboxylic acid. InChIKey: CWWWWJZMLMUDIM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-methoxy-1H-indole-3-carboxylic acid |
| InChIKey | CWWWWJZMLMUDIM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)C(=O)O |
Computed by PubChem (NCBI)