cas: 361543-99-9 — see every product listed under this CAS number, including other names
4-Methoxy-2,6-dimethylphenylboronic acid 97% (CAS 361543-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151059-250mg |
| cas | 361543-99-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 314.75 Pln | |
| Ambeed | 25g | 843.19 Pln | |
| Ambeed | 100g | 2879.06 Pln | |
| Ambeed | 500g | 11300.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151059 |
(4-methoxy-2,6-dimethylphenyl)boronic acid (CAS 361543-99-9) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,6-dimethylphenyl)boronic acid. InChIKey: UOSSBXMFWPYHEF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,6-dimethylphenyl)boronic acid |
| InChIKey | UOSSBXMFWPYHEF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)