CAS 361543-99-9 appears in our catalog under these names: 4-Methoxy-2,6-dimethylphenylboronic acid, ≥97-<99%, 4-Methoxy-2,6-dimethylphenylboronic acid, 95-<97%, 4–Methoxy–2,6–dimethylphenylboronic Acid (contains varying amounts of Anhydride), 4-Methoxy-2,6-dimethylphenylboronic Acid (contains varying amounts of Anhydride), 4-Methoxy-2,6-dimethylphenylboronic acid, 97%, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 5g.
(4-methoxy-2,6-dimethylphenyl)boronic acid (CAS 361543-99-9) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,6-dimethylphenyl)boronic acid. InChIKey: UOSSBXMFWPYHEF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,6-dimethylphenyl)boronic acid |
| InChIKey | UOSSBXMFWPYHEF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)