4-Methoxybenzofuran-2-carboxylic acid, 98%
cas: 50551-59-2 — see every product listed under this CAS number, including other names
4-Methoxybenzofuran-2-carboxylic acid, 98% (CAS 50551-59-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A332336-10g |
| cas | 50551-59-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10726.87 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 2075.33 Pln | |
| Fluorochem | 5g | 3975.70 Pln | |
| Fluorochem | 10g | 6688.29 Pln | |
| Fluorochem | 25g | 13977.39 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-methoxy-1-benzofuran-2-carboxylic acid (CAS 50551-59-2) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 4-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: JDGOMFYYKYOPFZ-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | JDGOMFYYKYOPFZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C=C(O2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-methoxybenzofuran-2-carboxylic acid, 4-methoxy-2-Benzofurancarboxylic acid, 2-Benzofurancarboxylic acid, 4-methoxy-, JDGOMFYYKYOPFZ-UHFFFAOYSA-N, 4-methoxybenzofuran-2-carboxylicacid, 4-Methoxy-benzofuran-2-carboxylic acid, 4-methoxy-benzofuran-2-ylcarboxylic acid, 4-Methoxybenzo(b)furan-2-carboxylic acid