cas: 19438-61-0 — see every product listed under this CAS number, including other names
4-Methylphthalic Anhydride, >98.0%(GC)(T) (CAS 19438-61-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0559-25G |
| cas | 19438-61-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 374.04 Pln | |
| TCI | 500g | 3142.45 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
5-methyl-2-benzofuran-1,3-dione (CAS 19438-61-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-methyl-2-benzofuran-1,3-dione. InChIKey: ZOXBWJMCXHTKNU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-methyl-2-benzofuran-1,3-dione |
| InChIKey | ZOXBWJMCXHTKNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)