cas: 19438-61-0 — see every product listed under this CAS number, including other names
5-Methyl-2-benzofuran-1,3-dione, 95% (CAS 19438-61-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069181-5G |
| cas | 19438-61-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 633.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-methyl-2-benzofuran-1,3-dione (CAS 19438-61-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-methyl-2-benzofuran-1,3-dione. InChIKey: ZOXBWJMCXHTKNU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-methyl-2-benzofuran-1,3-dione |
| InChIKey | ZOXBWJMCXHTKNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)