cas: 19438-61-0 — see every product listed under this CAS number, including other names
5-METHYLISOBENZOFURAN-1,3-DIONE, 98%, 98% (CAS 19438-61-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145AU-5g |
| cas | 19438-61-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 419.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2-benzofuran-1,3-dione (CAS 19438-61-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-methyl-2-benzofuran-1,3-dione. InChIKey: ZOXBWJMCXHTKNU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-methyl-2-benzofuran-1,3-dione |
| InChIKey | ZOXBWJMCXHTKNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)