cas: 1131-61-9 — see every product listed under this CAS number, including other names
4-Phenylpyridine 1-oxide, 98%, 98% (CAS 1131-61-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LZJ-250mg |
| cas | 1131-61-9 |
| size | 250mg |
| availability | 29g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 25g | 1274.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-oxido-4-phenylpyridin-1-ium (CAS 1131-61-9) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-oxido-4-phenylpyridin-1-ium. InChIKey: VZOPVKZLLGMDDG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-oxido-4-phenylpyridin-1-ium |
| InChIKey | VZOPVKZLLGMDDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)