cas: 100119-45-7 — see every product listed under this CAS number, including other names
4-Phenyltetrahydro-2H-pyran-4-carbonyl chloride, 97% (CAS 100119-45-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A971515-5g |
| cas | 100119-45-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10479.49 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-phenyloxane-4-carbonyl chloride (CAS 100119-45-7) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 4-phenyloxane-4-carbonyl chloride. InChIKey: MNCVQLSKZIVCDW-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 4-phenyloxane-4-carbonyl chloride |
| InChIKey | MNCVQLSKZIVCDW-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)