cas: 383133-62-8 — see every product listed under this CAS number, including other names
4-chloro-6-fluoro-1H-indole-2-carboxylic acid, 97%, 97% (CAS 383133-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYNO-100mg |
| cas | 383133-62-8 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 500mg | 1086.80 Pln | |
| Chemat | 1g | 1590.80 Pln | |
| Chemat | 5g | 4653.20 Pln | |
| Chemat | 10g | 7715.60 Pln | |
| Chemat | 25g | 15371.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-6-fluoro-1H-indole-2-carboxylic acid (CAS 383133-62-8) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 4-chloro-6-fluoro-1H-indole-2-carboxylic acid. InChIKey: RDHOUUUIUOTJBC-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 4-chloro-6-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | RDHOUUUIUOTJBC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)