CAS 383132-37-4 appears in our catalog under these names: 5-Chloro-7-fluoro-1h-indole-2-carboxylic acid, 95%, 5-Chloro-7-fluoro-1H-indole-2-carboxylic acid, 5-Chloro-7-fluoro-1H-indole-2-carboxylic acid, 98%, 98%, 5-Chloro-7-fluoro-1H-indole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg.
5-chloro-7-fluoro-1H-indole-2-carboxylic acid (CAS 383132-37-4) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 5-chloro-7-fluoro-1H-indole-2-carboxylic acid. InChIKey: XQOYTKZOWZWKPP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 5-chloro-7-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | XQOYTKZOWZWKPP-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)