CAS 887572-86-3 is the registry number for 3-Chloro-6-fluoro-4-hydroxyquinolin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-6-fluoro-4-hydroxy-1H-quinolin-2-one (CAS 887572-86-3) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 3-chloro-6-fluoro-4-hydroxy-1H-quinolin-2-one. InChIKey: YNZVXCDHIWKQTR-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 3-chloro-6-fluoro-4-hydroxy-1H-quinolin-2-one |
| InChIKey | YNZVXCDHIWKQTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=C(C(=O)N2)Cl)O |
Computed by PubChem (NCBI)