CAS 186446-27-5 is the registry number for 6-Chloro-4-fluoro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
6-chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS 186446-27-5) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 6-chloro-4-fluoro-1H-indole-2-carboxylic acid. InChIKey: WXQBCNRBBDRVJD-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 6-chloro-4-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | WXQBCNRBBDRVJD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)F)Cl |
Computed by PubChem (NCBI)