Products 186446-27-5

CAS 186446-27-5 is the registry number for 6-Chloro-4-fluoro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

6-chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS 186446-27-5) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 6-chloro-4-fluoro-1H-indole-2-carboxylic acid. InChIKey: WXQBCNRBBDRVJD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClFNO2
Molecular weight213.59 g/mol
IUPAC name6-chloro-4-fluoro-1H-indole-2-carboxylic acid
InChIKeyWXQBCNRBBDRVJD-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1NC(=C2)C(=O)O)F)Cl

Computed by PubChem (NCBI)