CAS 2379321-38-5 is the registry number for 6-Chloro-3-fluoro-2-(oxazol-5-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-chloro-3-fluoro-2-(1,3-oxazol-5-yl)phenol (CAS 2379321-38-5) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 6-chloro-3-fluoro-2-(1,3-oxazol-5-yl)phenol. InChIKey: FXYDWHRMBBLKNP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 6-chloro-3-fluoro-2-(1,3-oxazol-5-yl)phenol |
| InChIKey | FXYDWHRMBBLKNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C2=CN=CO2)O)Cl |
Computed by PubChem (NCBI)