Products 1547144-65-9

CAS 1547144-65-9 is the registry number for 6-Chloro-3-fluoro-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloro-3-fluoro-1H-indole-2-carboxylic acid (CAS 1547144-65-9) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 6-chloro-3-fluoro-1H-indole-2-carboxylic acid. InChIKey: SQGQSSNVYFUTGD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClFNO2
Molecular weight213.59 g/mol
IUPAC name6-chloro-3-fluoro-1H-indole-2-carboxylic acid
InChIKeySQGQSSNVYFUTGD-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)NC(=C2F)C(=O)O

Computed by PubChem (NCBI)