Products 2383366-02-5

CAS 2383366-02-5 is the registry number for 4-Cyano-2-fluoro-6-methoxybenzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyano-2-fluoro-6-methoxybenzoyl chloride (CAS 2383366-02-5) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 4-cyano-2-fluoro-6-methoxybenzoyl chloride. InChIKey: HKCTYZVMWUMEEG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClFNO2
Molecular weight213.59 g/mol
IUPAC name4-cyano-2-fluoro-6-methoxybenzoyl chloride
InChIKeyHKCTYZVMWUMEEG-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C#N)F)C(=O)Cl

Computed by PubChem (NCBI)