CAS 1430805-27-8 is the registry number for 8-Chloro-6-fluoro-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-fluoro-2-methyl-3,1-benzoxazin-4-one (CAS 1430805-27-8) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 8-chloro-6-fluoro-2-methyl-3,1-benzoxazin-4-one. InChIKey: AYFOAOKIQNHWNW-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 8-chloro-6-fluoro-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | AYFOAOKIQNHWNW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2Cl)F)C(=O)O1 |
Computed by PubChem (NCBI)