cas: 1676-90-0 — see every product listed under this CAS number, including other names
4-tert-Butyl N-(tert-Butoxycarbonyl)-L-aspartate, >98.0%(HPLC)(T) (CAS 1676-90-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3935-1G |
| cas | 1676-90-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 192.10 Pln | |
| TCI | 5g | 619.90 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 1676-90-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)