cas: 1676-90-0 — see every product listed under this CAS number, including other names
Boc-Asp(OtBu)-OH 97% (CAS 1676-90-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148662-1000g |
| cas | 1676-90-0 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2606.50 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 387.06 Pln | |
| Ambeed | 500g | 1649.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148662 |
(2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 1676-90-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)