cas: 1676-90-0 — see every product listed under this CAS number, including other names
Boc-Asp(OtBu)-OH, 99.78% (CAS 1676-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002326-100 g |
| cas | 1676-90-0 |
| size | 100 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 505.45 Pln | |
| MedChemExpress | 25 g | 240.74 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.78% |
(2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 1676-90-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)