cas: 1676-90-0 — see every product listed under this CAS number, including other names
Boc-L-Asp(OtBu)-OH (CAS 1676-90-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | BAA1075.0005 |
| cas | 1676-90-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 5g | 511.28 Pln | |
| Iris Biotech | 25g | 1113.20 Pln | |
| Iris Biotech | 100g | 2417.36 Pln | |
| Iris Biotech | 250g | 3571.04 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
(2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 1676-90-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)