cas: 103068-20-8 — see every product listed under this CAS number, including other names
5'-Bromo-1,1':3',1''-terphenyl, 98%, 98% (CAS 103068-20-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SES-1kg |
| cas | 103068-20-8 |
| size | 1kg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4336.40 Pln | |
| Chemat | 5kg | 16708.80 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 500g | 2212.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3,5-diphenylbenzene (CAS 103068-20-8) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-3,5-diphenylbenzene. InChIKey: IOPQERQQZZREDR-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-3,5-diphenylbenzene |
| InChIKey | IOPQERQQZZREDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)