cas: 19190-91-1 — see every product listed under this CAS number, including other names
5,6-Dibromo-1,2-dihydroacenaphthylene 95% (CAS 19190-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210921-100g |
| cas | 19190-91-1 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 8586.19 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 10g | 1393.88 Pln | |
| Ambeed | 25g | 2728.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210921 |
5,6-dibromo-1,2-dihydroacenaphthylene (CAS 19190-91-1) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 5,6-dibromo-1,2-dihydroacenaphthylene. InChIKey: UXSHNPXCELYWAW-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 5,6-dibromo-1,2-dihydroacenaphthylene |
| InChIKey | UXSHNPXCELYWAW-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=C(C=CC1=C23)Br)Br |
Computed by PubChem (NCBI)