cas: 71293-59-9 — see every product listed under this CAS number, including other names
5,6-Dichloroindolin-2-one 98% (CAS 71293-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A931729-250mg |
| cas | 71293-59-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 25g | 3618.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A931729 |
5,6-dichloro-1,3-dihydroindol-2-one (CAS 71293-59-9) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 5,6-dichloro-1,3-dihydroindol-2-one. InChIKey: ADDAYZCZQHOPJX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 5,6-dichloro-1,3-dihydroindol-2-one |
| InChIKey | ADDAYZCZQHOPJX-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)Cl |
Computed by PubChem (NCBI)