cas: 959238-71-2 — see every product listed under this CAS number, including other names
5,6-Difluoro-1H-indole-3-carboxylic acid, 98% (CAS 959238-71-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F625672-100MG |
| cas | 959238-71-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1486.99 Pln | |
| Fluorochem | 5g | 5839.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,6-difluoro-1H-indole-3-carboxylic acid (CAS 959238-71-2) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 5,6-difluoro-1H-indole-3-carboxylic acid. InChIKey: CLBRCFZJWOOLLI-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5,6-difluoro-1H-indole-3-carboxylic acid |
| InChIKey | CLBRCFZJWOOLLI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2C(=O)O |
Computed by PubChem (NCBI)