cas: 2107-69-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-1-indanone 98% (CAS 2107-69-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120912-25g |
| cas | 2107-69-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 264.69 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120912 |
5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2107-69-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: IHMQOBPGHZFGLC-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)OC |
Computed by PubChem (NCBI)