cas: 2107-69-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxyindan-1-one, 99.86% (CAS 2107-69-9) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g, 100 g, 1 kg, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y0917-25 g |
| cas | 2107-69-9 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 273.25 Pln | |
| MedChemExpress | 50 g | 361.49 Pln | |
| MedChemExpress | 100 g | 477.59 Pln | |
| MedChemExpress | 1 kg | 1536.42 Pln | |
| MedChemExpress | 500 g | 1007.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.86% |
5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2107-69-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: IHMQOBPGHZFGLC-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)OC |
Computed by PubChem (NCBI)