cas: 2107-69-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-1-indanone, 95%+, 95%+ (CAS 2107-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KXP-1g |
| cas | 2107-69-9 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 456.00 Pln | |
| Chemat | 1kg | 832.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2107-69-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: IHMQOBPGHZFGLC-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)OC |
Computed by PubChem (NCBI)