cas: 2107-69-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-indan-1-one (CAS 2107-69-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040460-5G |
| cas | 2107-69-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 174.96 Pln | |
| Fluorochem | 500g | 575.86 Pln |
| delivery time | 1-2 weeks |
|---|
5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2107-69-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: IHMQOBPGHZFGLC-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)OC |
Computed by PubChem (NCBI)