cas: 75291-84-8 — see every product listed under this CAS number, including other names
5,6-dichloropyridine-3-carboxamide, ≥95%, ≥95% (CAS 75291-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116YHG-1g |
| cas | 75291-84-8 |
| size | 1g |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 947.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5,6-dichloropyridine-3-carboxamide (CAS 75291-84-8) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 5,6-dichloropyridine-3-carboxamide. InChIKey: MPXFKNFJVCEHKV-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 5,6-dichloropyridine-3-carboxamide |
| InChIKey | MPXFKNFJVCEHKV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)