cas: 67604-48-2 — see every product listed under this CAS number, including other names
5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one (CAS 67604-48-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F320310-1G |
| cas | 67604-48-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 419.66 Pln | |
| Fluorochem | 500g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
Naringenin is a trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. It is a member of 4'-hydroxyflavanones and a trihydroxyflavanone.
Source: ChEBI
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | FTVWIRXFELQLPI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)