CAS 885958-97-4 is the registry number for 5-(3,5-Difluorophenyl)isoxazole-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 885958-97-4) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: LBDHRKQMMXWKFA-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | LBDHRKQMMXWKFA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)