Products 885958-97-4

CAS 885958-97-4 is the registry number for 5-(3,5-Difluorophenyl)isoxazole-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 885958-97-4) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: LBDHRKQMMXWKFA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5F2NO3
Molecular weight225.15 g/mol
IUPAC name5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid
InChIKeyLBDHRKQMMXWKFA-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)F)C2=CC(=NO2)C(=O)O

Computed by PubChem (NCBI)