CAS 901926-82-7 is the registry number for 3-(2,4-Difluorophenyl)isoxazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 901926-82-7) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: KSVDLUJUAIVOLU-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | KSVDLUJUAIVOLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)