CAS 901926-86-1 appears in our catalog under these names: 3-(2,5-Difluorophenyl)-1,2-oxazole-5-carboxylic acid, 95%, 3-(2,5-Difluorophenyl)-1,2-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(2,5-difluorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 901926-86-1) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: CORJOVLCLCEXNX-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | CORJOVLCLCEXNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=NOC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)