Products 1083224-23-0
CAS 1083224-23-0 appears in our catalog under these names: 5-(2,4-Difluorophenyl)isoxazole-3-carboxylic acid, 98%, 5–(2，4–Difluorophenyl)isoxazole–3–carboxylic Acid, 5-(2,4-Difluorophenyl)Isoxazole-3-carboxylic acid, 5-(2,4-Difluorophenyl)isoxazole-3-carboxylic acid 97%, 5-(2,4-Difluorophenyl)isoxazole-3-carboxylic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1083224-23-0) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: FQAFQXBZWSTPRH-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | FQAFQXBZWSTPRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)