CAS 228728-17-4 appears in our catalog under these names: 7,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid, 7,8-Difluoro-4-hydroxyquinoline-3-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
7,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 228728-17-4) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 7,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: NGWHDXXMYRPDOB-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 7,8-difluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | NGWHDXXMYRPDOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=CN2)C(=O)O)F)F |
Computed by PubChem (NCBI)