5-((Methylsulfonyl)methyl)isoxazole-3-carboxylic acid, 95%
cas: 84654-31-9 — see every product listed under this CAS number, including other names
5-((Methylsulfonyl)methyl)isoxazole-3-carboxylic acid, 95% (CAS 84654-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2449152-100mg |
| cas | 84654-31-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 1594.12 Pln | |
| Ambeed | 1g | 4180.69 Pln | |
| Ambeed | 5g | 16512.75 Pln | |
| BLDpharm | 50mg | 608.70 Pln | |
| BLDpharm | 100mg | 980.79 Pln | |
| BLDpharm | 250mg | 1713.87 Pln | |
| BLDpharm | 1g | 4501.77 Pln | |
| BLDpharm | 5g | 17797.09 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid (CAS 84654-31-9) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: JYZYBISLHGKOKG-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | JYZYBISLHGKOKG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=NO1)C(=O)O |
Computed by PubChem (NCBI)