CAS 1338976-77-4 appears in our catalog under these names: 2-(Methanesulfonylmethyl)-1,3-oxazole-4-carboxylic acid, 2-(Methanesulfonylmethyl)-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(methylsulfonylmethyl)-1,3-oxazole-4-carboxylic acid (CAS 1338976-77-4) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 2-(methylsulfonylmethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: RWIHDCNMTYYBPY-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 2-(methylsulfonylmethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | RWIHDCNMTYYBPY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=NC(=CO1)C(=O)O |
Computed by PubChem (NCBI)