Products 1870587-81-7

CAS 1870587-81-7 is the registry number for Methyl 5-sulfamoylfuran-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-sulfamoylfuran-3-carboxylate (CAS 1870587-81-7) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: methyl 5-sulfamoylfuran-3-carboxylate. InChIKey: GSCCGAVXBUXYOM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO5S
Molecular weight205.19 g/mol
IUPAC namemethyl 5-sulfamoylfuran-3-carboxylate
InChIKeyGSCCGAVXBUXYOM-UHFFFAOYSA-N
SMILESCOC(=O)C1=COC(=C1)S(=O)(=O)N

Computed by PubChem (NCBI)