Products 1892952-66-7
CAS 1892952-66-7 is the registry number for 2-((Methylsulfonyl)methyl)oxazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylic acid (CAS 1892952-66-7) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylic acid. InChIKey: FNGCGBMYNGZWNX-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 2-(methylsulfonylmethyl)-1,3-oxazole-5-carboxylic acid |
| InChIKey | FNGCGBMYNGZWNX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=NC=C(O1)C(=O)O |
Computed by PubChem (NCBI)