Products 2773493-65-3
CAS 2773493-65-3 is the registry number for 5-(Sulfamoylmethyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(sulfamoylmethyl)furan-2-carboxylic acid (CAS 2773493-65-3) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 5-(sulfamoylmethyl)furan-2-carboxylic acid. InChIKey: JDJWQJRKAUOAHT-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 5-(sulfamoylmethyl)furan-2-carboxylic acid |
| InChIKey | JDJWQJRKAUOAHT-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CS(=O)(=O)N |
Computed by PubChem (NCBI)