Products 84654-31-9
CAS 84654-31-9 appears in our catalog under these names: 5-(Methanesulfonylmethyl)-1,2-oxazole-3-carboxylic acid, 5-((Methylsulfonyl)methyl)isoxazole-3-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid (CAS 84654-31-9) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: JYZYBISLHGKOKG-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 5-(methylsulfonylmethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | JYZYBISLHGKOKG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=NO1)C(=O)O |
Computed by PubChem (NCBI)