Products 933742-92-8

CAS 933742-92-8 is the registry number for 5-(Methylsulfamoyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-(methylsulfamoyl)furan-2-carboxylic acid (CAS 933742-92-8) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: 5-(methylsulfamoyl)furan-2-carboxylic acid. InChIKey: KZPZTIAMDLGCSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO5S
Molecular weight205.19 g/mol
IUPAC name5-(methylsulfamoyl)furan-2-carboxylic acid
InChIKeyKZPZTIAMDLGCSJ-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)