CAS 1609400-31-8 is the registry number for 2-Methyl-1,3-thiazole-4-carboxylic acid carbonic acid (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
Carbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid (CAS 1609400-31-8) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: carbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid. InChIKey: RBKLFKYYIZXGPJ-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5S |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | carbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | RBKLFKYYIZXGPJ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C(=O)O.C(=O)(O)O |
Computed by PubChem (NCBI)