Products 1609400-31-8

CAS 1609400-31-8 is the registry number for 2-Methyl-1,3-thiazole-4-carboxylic acid carbonic acid (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Carbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid (CAS 1609400-31-8) is a chemical compound with the molecular formula C6H7NO5S and a molecular weight of 205.19 g/mol. IUPAC name: carbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid. InChIKey: RBKLFKYYIZXGPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO5S
Molecular weight205.19 g/mol
IUPAC namecarbonic acid;2-methyl-1,3-thiazole-4-carboxylic acid
InChIKeyRBKLFKYYIZXGPJ-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)C(=O)O.C(=O)(O)O

Computed by PubChem (NCBI)