cas: 23269-92-3 — see every product listed under this CAS number, including other names
5-(3,4,5-Trimethoxy-phenyl)-[1,3,4]oxadiazole-2-thiol, 98% (CAS 23269-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058018-100MG |
| cas | 23269-92-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1664.02 Pln | |
| Fluorochem | 10g | 2861.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 23269-92-3) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: IYUWDYZWKDQESI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 5-(3,4,5-trimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | IYUWDYZWKDQESI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)